C19H17BrN4O5 — CID 3099781
2-(2-bromo-4-methoxyphenoxy)-N-[(2-methyl-6-nitro-1H-indol-3-yl)methylideneamino]acetamide (PubChem CID 3099781) has the molecular formula C19H17BrN4O5 and a molecular weight of 461.27 g/mol. Its IUPAC name is 2-(2-bromo-4-methoxyphenoxy)-N-[(2-methyl-6-nitro-1H-indol-3-yl)methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-methoxyphenoxy)-N-[(2-methyl-6-nitro-1H-indol-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3099781 |
| Molecular Formula | C19H17BrN4O5 |
| Molecular Weight | 461.27 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 2-(2-bromo-4-methoxyphenoxy)-N-[(2-methyl-6-nitro-1H-indol-3-yl)methylideneamino]acetamide |
| SMILES | COc1ccc(OCC(=O)NN=Cc2c(C)[nH]c3cc([N+](=O)[O-])ccc23)c(Br)c1 |
| InChI | InChI=1S/C19H17BrN4O5/c1-11-15(14-5-3-12(24(26)27)7-17(14)22-11)9-21-23-19(25)10-29-18-6-4-13(28-2)8-16(18)20/h3-9,22H,10H2,1-2H3,(H,23,25) |
| InChIKey | IQRLXCGEVJUEBL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|