C13H18Br2NO+ — CID 3110664
2,3-dibromopropyl-dimethyl-phenacylazanium (PubChem CID 3110664) has the molecular formula C13H18Br2NO+ and a molecular weight of 364.10 g/mol. Its IUPAC name is 2,3-dibromopropyl-dimethyl-phenacylazanium.
| Compound Name | 2,3-dibromopropyl-dimethyl-phenacylazanium |
|---|---|
| PubChem CID | 3110664 |
| Molecular Formula | C13H18Br2NO+ |
| Molecular Weight | 364.10 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 2,3-dibromopropyl-dimethyl-phenacylazanium |
| SMILES | C[N+](C)(CC(=O)c1ccccc1)CC(Br)CBr |
| InChI | InChI=1S/C13H18Br2NO/c1-16(2,9-12(15)8-14)10-13(17)11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3/q+1 |
| InChIKey | SRVZSPUBPBPNGZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.10 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|