C18H20ClNO7S — CID 31120967
methyl 2-[[3-(tert-butylsulfamoyl)-4-chlorobenzoyl]oxymethyl]furan-3-carboxylate (PubChem CID 31120967) has the molecular formula C18H20ClNO7S and a molecular weight of 429.88 g/mol. Its IUPAC name is methyl 2-[[3-(tert-butylsulfamoyl)-4-chlorobenzoyl]oxymethyl]furan-3-carboxylate.
| Compound Name | methyl 2-[[3-(tert-butylsulfamoyl)-4-chlorobenzoyl]oxymethyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 31120967 |
| Molecular Formula | C18H20ClNO7S |
| Molecular Weight | 429.88 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | methyl 2-[[3-(tert-butylsulfamoyl)-4-chlorobenzoyl]oxymethyl]furan-3-carboxylate |
| SMILES | COC(=O)c1ccoc1COC(=O)c1ccc(Cl)c(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C18H20ClNO7S/c1-18(2,3)20-28(23,24)15-9-11(5-6-13(15)19)16(21)27-10-14-12(7-8-26-14)17(22)25-4/h5-9,20H,10H2,1-4H3 |
| InChIKey | HQLIGJXBFGBKQZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.88 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |