C28H31N7O2 — CID 31308705
N-[4-(4-benzylpiperazin-1-yl)phenyl]-1-(6-ethoxypyridazin-3-yl)-5-methylpyrazole-4-carboxamide (PubChem CID 31308705) has the molecular formula C28H31N7O2 and a molecular weight of 497.60 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-1-(6-ethoxypyridazin-3-yl)-5-methylpyrazole-4-carboxamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-1-(6-ethoxypyridazin-3-yl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 31308705 |
| Molecular Formula | C28H31N7O2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-1-(6-ethoxypyridazin-3-yl)-5-methylpyrazole-4-carboxamide |
| SMILES | CCOc1ccc(-n2ncc(C(=O)Nc3ccc(N4CCN(Cc5ccccc5)CC4)cc3)c2C)nn1 |
| InChI | InChI=1S/C28H31N7O2/c1-3-37-27-14-13-26(31-32-27)35-21(2)25(19-29-35)28(36)30-23-9-11-24(12-10-23)34-17-15-33(16-18-34)20-22-7-5-4-6-8-22/h4-14,19H,3,15-18,20H2,1-2H3,(H,30,36) |
| InChIKey | HFCDJBMBPGGJQZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|