C17H29N3O2 — CID 31700734
(6S,10S)-3-[[ethyl(2-methylprop-2-enyl)amino]methyl]-6,10-dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 31700734) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is (6S,10S)-3-[[ethyl(2-methylprop-2-enyl)amino]methyl]-6,10-dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (6S,10S)-3-[[ethyl(2-methylprop-2-enyl)amino]methyl]-6,10-dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 31700734 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | (6S,10S)-3-[[ethyl(2-methylprop-2-enyl)amino]methyl]-6,10-dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C=C(C)CN(CC)CN1C(=O)NC2(C1=O)[C@@H](C)CCC[C@@H]2C |
| InChI | InChI=1S/C17H29N3O2/c1-6-19(10-12(2)3)11-20-15(21)17(18-16(20)22)13(4)8-7-9-14(17)5/h13-14H,2,6-11H2,1,3-5H3,(H,18,22)/t13-,14-/m0/s1 |
| InChIKey | REKPAHCRPKBWJU-KBPBESRZSA-N |
| XLogP | 2.59 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|