C23H21ClN2O6 — CID 31837720
N'-[2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)acetyl]-5-(phenoxymethyl)furan-2-carbohydrazide (PubChem CID 31837720) has the molecular formula C23H21ClN2O6 and a molecular weight of 456.88 g/mol. Its IUPAC name is N'-[2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)acetyl]-5-(phenoxymethyl)furan-2-carbohydrazide.
| Compound Name | N'-[2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)acetyl]-5-(phenoxymethyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 31837720 |
| Molecular Formula | C23H21ClN2O6 |
| Molecular Weight | 456.88 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | N'-[2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)acetyl]-5-(phenoxymethyl)furan-2-carbohydrazide |
| SMILES | O=C(Cc1cc(Cl)c2c(c1)OCCCO2)NNC(=O)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C23H21ClN2O6/c24-18-11-15(12-20-22(18)30-10-4-9-29-20)13-21(27)25-26-23(28)19-8-7-17(32-19)14-31-16-5-2-1-3-6-16/h1-3,5-8,11-12H,4,9-10,13-14H2,(H,25,27)(H,26,28) |
| InChIKey | GWQVBQQQXHXXFE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.88 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|