About 4,5-dimethoxy-N,N-dimethyl-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide
4,5-dimethoxy-N,N-dimethyl-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide (PubChem CID 32511449) has the molecular formula C19H27N3O5
and a molecular weight of 377.44 g/mol. Its IUPAC name is 4,5-dimethoxy-N,N-dimethyl-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide.
Molecular Properties
| Compound Name | 4,5-dimethoxy-N,N-dimethyl-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide |
| PubChem CID | 32511449 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 4,5-dimethoxy-N,N-dimethyl-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide |
| SMILES | COc1cc(NC(=O)CN2CCCCCC2=O)c(C(=O)N(C)C)cc1OC |
| InChI | InChI=1S/C19H27N3O5/c1-21(2)19(25)13-10-15(26-3)16(27-4)11-14(13)20-17(23)12-22-9-7-5-6-8-18(22)24/h10-11H,5-9,12H2,1-4H3,(H,20,23) |
| InChIKey | GUCZHRBIYZXGKJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-dimethoxy-N,N-dimethyl-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethoxy-N,N-dimethyl-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide?
The IUPAC name of 4,5-dimethoxy-N,N-dimethyl-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide (CID 32511449) is 4,5-dimethoxy-N,N-dimethyl-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide.
What is the SMILES notation for 4,5-dimethoxy-N,N-dimethyl-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide?
The canonical SMILES for 4,5-dimethoxy-N,N-dimethyl-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide is COc1cc(NC(=O)CN2CCCCCC2=O)c(C(=O)N(C)C)cc1OC.
What is the InChIKey of 4,5-dimethoxy-N,N-dimethyl-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide?
The InChIKey is GUCZHRBIYZXGKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O5/c1-21(2)19(25)13-10-15(26-3)16(27-4)11-14(13)20-17(23)12-22-9-7-5-6-8-18(22)24/h10-11H,5-9,12H2,1-4H3,(H,20,23).
What are the key properties of 4,5-dimethoxy-N,N-dimethyl-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide?
4,5-dimethoxy-N,N-dimethyl-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide has a molecular weight of 377.44 g/mol, XLogP of 1.75, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethoxy-N,N-dimethyl-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]benzamide is sourced from PubChem (CID 32511449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).