C13H10Br3N3O2S — CID 3254971
2-pyrimidin-2-ylsulfanyl-N-(3,4,5-tribromo-2-methoxyphenyl)acetamide (PubChem CID 3254971) has the molecular formula C13H10Br3N3O2S and a molecular weight of 512.02 g/mol. Its IUPAC name is 2-pyrimidin-2-ylsulfanyl-N-(3,4,5-tribromo-2-methoxyphenyl)acetamide.
| Compound Name | 2-pyrimidin-2-ylsulfanyl-N-(3,4,5-tribromo-2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3254971 |
| Molecular Formula | C13H10Br3N3O2S |
| Molecular Weight | 512.02 g/mol |
| Exact Mass | 508.80 |
| IUPAC Name | 2-pyrimidin-2-ylsulfanyl-N-(3,4,5-tribromo-2-methoxyphenyl)acetamide |
| SMILES | COc1c(NC(=O)CSc2ncccn2)cc(Br)c(Br)c1Br |
| InChI | InChI=1S/C13H10Br3N3O2S/c1-21-12-8(5-7(14)10(15)11(12)16)19-9(20)6-22-13-17-3-2-4-18-13/h2-5H,6H2,1H3,(H,19,20) |
| InChIKey | HPBRVTOBSHFPQU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.02 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|