C23H22N6O4S — CID 32659663
N'-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoyl]-4-oxo-3-propylphthalazine-1-carbohydrazide (PubChem CID 32659663) has the molecular formula C23H22N6O4S and a molecular weight of 478.53 g/mol. Its IUPAC name is N'-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoyl]-4-oxo-3-propylphthalazine-1-carbohydrazide.
| Compound Name | N'-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoyl]-4-oxo-3-propylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 32659663 |
| Molecular Formula | C23H22N6O4S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | N'-[2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoyl]-4-oxo-3-propylphthalazine-1-carbohydrazide |
| SMILES | CCCn1nc(C(=O)NNC(=O)c2ccccc2SCc2nc(C)no2)c2ccccc2c1=O |
| InChI | InChI=1S/C23H22N6O4S/c1-3-12-29-23(32)16-9-5-4-8-15(16)20(27-29)22(31)26-25-21(30)17-10-6-7-11-18(17)34-13-19-24-14(2)28-33-19/h4-11H,3,12-13H2,1-2H3,(H,25,30)(H,26,31) |
| InChIKey | CKQMDKAIKHOMDW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|