C18H17BrNS+ — CID 3271056
4-(4-bromophenyl)-3-methyl-2-(2-phenylethyl)-1,3-thiazol-3-ium (PubChem CID 3271056) has the molecular formula C18H17BrNS+ and a molecular weight of 359.31 g/mol. Its IUPAC name is 4-(4-bromophenyl)-3-methyl-2-(2-phenylethyl)-1,3-thiazol-3-ium.
| Compound Name | 4-(4-bromophenyl)-3-methyl-2-(2-phenylethyl)-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 3271056 |
| Molecular Formula | C18H17BrNS+ |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 4-(4-bromophenyl)-3-methyl-2-(2-phenylethyl)-1,3-thiazol-3-ium |
| SMILES | C[n+]1c(-c2ccc(Br)cc2)csc1CCc1ccccc1 |
| InChI | InChI=1S/C18H17BrNS/c1-20-17(15-8-10-16(19)11-9-15)13-21-18(20)12-7-14-5-3-2-4-6-14/h2-6,8-11,13H,7,12H2,1H3/q+1 |
| InChIKey | INKJHQYFIKWYNC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|