C24H17N3O4S2 — CID 3289899
[2-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenyl] 4-acetamidobenzenesulfonate (PubChem CID 3289899) has the molecular formula C24H17N3O4S2 and a molecular weight of 475.55 g/mol. Its IUPAC name is [2-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [2-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 3289899 |
| Molecular Formula | C24H17N3O4S2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | [2-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenyl] 4-acetamidobenzenesulfonate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Oc2ccccc2C=C(C#N)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C24H17N3O4S2/c1-16(28)26-19-10-12-20(13-11-19)33(29,30)31-22-8-4-2-6-17(22)14-18(15-25)24-27-21-7-3-5-9-23(21)32-24/h2-14H,1H3,(H,26,28) |
| InChIKey | ZAVPFEBFEPJHFB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|