C19H17NOS — CID 3306493
2,3-diphenyl-3,9a-dihydro-2H-pyrido[1,2-b][1,4,2]oxathiazine (PubChem CID 3306493) has the molecular formula C19H17NOS and a molecular weight of 307.42 g/mol. Its IUPAC name is 2,3-diphenyl-3,9a-dihydro-2H-pyrido[1,2-b][1,4,2]oxathiazine.
| Compound Name | 2,3-diphenyl-3,9a-dihydro-2H-pyrido[1,2-b][1,4,2]oxathiazine |
|---|---|
| PubChem CID | 3306493 |
| Molecular Formula | C19H17NOS |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2,3-diphenyl-3,9a-dihydro-2H-pyrido[1,2-b][1,4,2]oxathiazine |
| SMILES | C1=CC2SC(c3ccccc3)C(c3ccccc3)ON2C=C1 |
| InChI | InChI=1S/C19H17NOS/c1-3-9-15(10-4-1)18-19(16-11-5-2-6-12-16)22-17-13-7-8-14-20(17)21-18/h1-14,17-19H |
| InChIKey | FEKZDSAMWLFLOF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |