C21H17ClN4O3S2 — CID 3320764
3-(2-chlorophenyl)-N-[(6-ethoxy-1,3-benzothiazol-2-yl)carbamothioyl]-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 3320764) has the molecular formula C21H17ClN4O3S2 and a molecular weight of 472.98 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[(6-ethoxy-1,3-benzothiazol-2-yl)carbamothioyl]-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-N-[(6-ethoxy-1,3-benzothiazol-2-yl)carbamothioyl]-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3320764 |
| Molecular Formula | C21H17ClN4O3S2 |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[(6-ethoxy-1,3-benzothiazol-2-yl)carbamothioyl]-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CCOc1ccc2nc(NC(=S)NC(=O)c3c(-c4ccccc4Cl)noc3C)sc2c1 |
| InChI | InChI=1S/C21H17ClN4O3S2/c1-3-28-12-8-9-15-16(10-12)31-21(23-15)25-20(30)24-19(27)17-11(2)29-26-18(17)13-6-4-5-7-14(13)22/h4-10H,3H2,1-2H3,(H2,23,24,25,27,30) |
| InChIKey | NRDLGQHQOURBCT-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|