C16H18F2N4O2S — CID 33245612
1-[2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanylacetyl]piperidine-4-carboxamide (PubChem CID 33245612) has the molecular formula C16H18F2N4O2S and a molecular weight of 368.41 g/mol. Its IUPAC name is 1-[2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanylacetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanylacetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 33245612 |
| Molecular Formula | C16H18F2N4O2S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1-[2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanylacetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)CSc2nc3ccccc3n2C(F)F)CC1 |
| InChI | InChI=1S/C16H18F2N4O2S/c17-15(18)22-12-4-2-1-3-11(12)20-16(22)25-9-13(23)21-7-5-10(6-8-21)14(19)24/h1-4,10,15H,5-9H2,(H2,19,24) |
| InChIKey | CFKBFNRQNDNULS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |