C19H13N4O+ — CID 3334614
3-(3-methylpyridin-1-ium-1-yl)-4-oxo-4-phenylbut-1-ene-1,1,2-tricarbonitrile (PubChem CID 3334614) has the molecular formula C19H13N4O+ and a molecular weight of 313.34 g/mol. Its IUPAC name is 3-(3-methylpyridin-1-ium-1-yl)-4-oxo-4-phenylbut-1-ene-1,1,2-tricarbonitrile.
| Compound Name | 3-(3-methylpyridin-1-ium-1-yl)-4-oxo-4-phenylbut-1-ene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 3334614 |
| Molecular Formula | C19H13N4O+ |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-(3-methylpyridin-1-ium-1-yl)-4-oxo-4-phenylbut-1-ene-1,1,2-tricarbonitrile |
| SMILES | Cc1ccc[n+](C(C(=O)c2ccccc2)C(C#N)=C(C#N)C#N)c1 |
| InChI | InChI=1S/C19H13N4O/c1-14-6-5-9-23(13-14)18(17(12-22)16(10-20)11-21)19(24)15-7-3-2-4-8-15/h2-9,13,18H,1H3/q+1 |
| InChIKey | JGZPJXYPPRBDBB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 92.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|