C24H18NO2+ — CID 7119580
2-isoquinolin-2-ium-2-yl-1,3-diphenylpropane-1,3-dione (PubChem CID 7119580) has the molecular formula C24H18NO2+ and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-isoquinolin-2-ium-2-yl-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-isoquinolin-2-ium-2-yl-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 7119580 |
| Molecular Formula | C24H18NO2+ |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-isoquinolin-2-ium-2-yl-1,3-diphenylpropane-1,3-dione |
| SMILES | O=C(c1ccccc1)C(C(=O)c1ccccc1)[n+]1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H18NO2/c26-23(19-10-3-1-4-11-19)22(24(27)20-12-5-2-6-13-20)25-16-15-18-9-7-8-14-21(18)17-25/h1-17,22H/q+1 |
| InChIKey | YNKYZASQKGKEOT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|