C20H15N2O+ — CID 101335610
1-(2-oxo-1,2-diphenylethyl)pyridin-1-ium-4-carbonitrile (PubChem CID 101335610) has the molecular formula C20H15N2O+ and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-(2-oxo-1,2-diphenylethyl)pyridin-1-ium-4-carbonitrile.
| Compound Name | 1-(2-oxo-1,2-diphenylethyl)pyridin-1-ium-4-carbonitrile |
|---|---|
| PubChem CID | 101335610 |
| Molecular Formula | C20H15N2O+ |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-(2-oxo-1,2-diphenylethyl)pyridin-1-ium-4-carbonitrile |
| SMILES | N#Cc1cc[n+](C(C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15N2O/c21-15-16-11-13-22(14-12-16)19(17-7-3-1-4-8-17)20(23)18-9-5-2-6-10-18/h1-14,19H/q+1 |
| InChIKey | MGZHPSSXPBZJMW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|