C18H12F17NO4 — CID 3350275
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-N-(3,4,5-trimethoxyphenyl)nonanamide (PubChem CID 3350275) has the molecular formula C18H12F17NO4 and a molecular weight of 629.26 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-N-(3,4,5-trimethoxyphenyl)nonanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-N-(3,4,5-trimethoxyphenyl)nonanamide |
|---|---|
| PubChem CID | 3350275 |
| Molecular Formula | C18H12F17NO4 |
| Molecular Weight | 629.26 g/mol |
| Exact Mass | 629.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-N-(3,4,5-trimethoxyphenyl)nonanamide |
| SMILES | COc1cc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc(OC)c1OC |
| InChI | InChI=1S/C18H12F17NO4/c1-38-7-4-6(5-8(39-2)9(7)40-3)36-10(37)11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)17(31,32)18(33,34)35/h4-5H,1-3H3,(H,36,37) |
| InChIKey | WVCJQGWSGGJZLY-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.26 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|