C13H12ClN5O2S — CID 3355812
N-[(4-chlorophenyl)methyl]-2-methylsulfonyl-7H-purin-6-amine (PubChem CID 3355812) has the molecular formula C13H12ClN5O2S and a molecular weight of 337.79 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-methylsulfonyl-7H-purin-6-amine.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-methylsulfonyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 3355812 |
| Molecular Formula | C13H12ClN5O2S |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-methylsulfonyl-7H-purin-6-amine |
| SMILES | CS(=O)(=O)c1nc(NCc2ccc(Cl)cc2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H12ClN5O2S/c1-22(20,21)13-18-11(10-12(19-13)17-7-16-10)15-6-8-2-4-9(14)5-3-8/h2-5,7H,6H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | JRWJZBXKNAWLGZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |