C13H12ClN5O3S — CID 162356591
[6-[(3-chlorophenyl)methylamino]-7H-purin-2-yl] methanesulfonate (PubChem CID 162356591) has the molecular formula C13H12ClN5O3S and a molecular weight of 353.79 g/mol. Its IUPAC name is [6-[(3-chlorophenyl)methylamino]-7H-purin-2-yl] methanesulfonate.
| Compound Name | [6-[(3-chlorophenyl)methylamino]-7H-purin-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 162356591 |
| Molecular Formula | C13H12ClN5O3S |
| Molecular Weight | 353.79 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | [6-[(3-chlorophenyl)methylamino]-7H-purin-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1nc(NCc2cccc(Cl)c2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H12ClN5O3S/c1-23(20,21)22-13-18-11(10-12(19-13)17-7-16-10)15-6-8-3-2-4-9(14)5-8/h2-5,7H,6H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | DCCKEUDUWVUUFH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.79 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|