C14H15N5O5S — CID 162356565
[6-[(4-hydroxy-2-methoxyphenyl)methylamino]-7H-purin-2-yl] methanesulfonate (PubChem CID 162356565) has the molecular formula C14H15N5O5S and a molecular weight of 365.37 g/mol. Its IUPAC name is [6-[(4-hydroxy-2-methoxyphenyl)methylamino]-7H-purin-2-yl] methanesulfonate.
| Compound Name | [6-[(4-hydroxy-2-methoxyphenyl)methylamino]-7H-purin-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 162356565 |
| Molecular Formula | C14H15N5O5S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | [6-[(4-hydroxy-2-methoxyphenyl)methylamino]-7H-purin-2-yl] methanesulfonate |
| SMILES | COc1cc(O)ccc1CNc1nc(OS(C)(=O)=O)nc2nc[nH]c12 |
| InChI | InChI=1S/C14H15N5O5S/c1-23-10-5-9(20)4-3-8(10)6-15-12-11-13(17-7-16-11)19-14(18-12)24-25(2,21)22/h3-5,7,20H,6H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | MMPJDOWVABYUAP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 139.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|