C13H13N5O2S — CID 86663302
6-[(2-hydroxy-3-methoxyphenyl)methylamino]-3,7-dihydropurine-2-thione (PubChem CID 86663302) has the molecular formula C13H13N5O2S and a molecular weight of 303.35 g/mol. Its IUPAC name is 6-[(2-hydroxy-3-methoxyphenyl)methylamino]-3,7-dihydropurine-2-thione.
| Compound Name | 6-[(2-hydroxy-3-methoxyphenyl)methylamino]-3,7-dihydropurine-2-thione |
|---|---|
| PubChem CID | 86663302 |
| Molecular Formula | C13H13N5O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 6-[(2-hydroxy-3-methoxyphenyl)methylamino]-3,7-dihydropurine-2-thione |
| SMILES | COc1cccc(CNc2nc(=S)[nH]c3nc[nH]c23)c1O |
| InChI | InChI=1S/C13H13N5O2S/c1-20-8-4-2-3-7(10(8)19)5-14-11-9-12(16-6-15-9)18-13(21)17-11/h2-4,6,19H,5H2,1H3,(H3,14,15,16,17,18,21) |
| InChIKey | FDTINRUDDTYOGJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|