C11H16ClN3O2S+2 — CID 3394511
3-(4-chlorophenyl)sulfonyl-3-aza-1,5-diazoniabicyclo[3.2.1]octane (PubChem CID 3394511) has the molecular formula C11H16ClN3O2S+2 and a molecular weight of 289.79 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-3-aza-1,5-diazoniabicyclo[3.2.1]octane.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-3-aza-1,5-diazoniabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 3394511 |
| Molecular Formula | C11H16ClN3O2S+2 |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-3-aza-1,5-diazoniabicyclo[3.2.1]octane |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1C[NH+]2CC[NH+](C1)C2 |
| InChI | InChI=1S/C11H14ClN3O2S/c12-10-1-3-11(4-2-10)18(16,17)15-8-13-5-6-14(7-13)9-15/h1-4H,5-9H2/p+2 |
| InChIKey | NCANXSRQGZTDKV-UHFFFAOYSA-P |
| XLogP | -2.00 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |