C17H10Cl2N4O3 — CID 3399450
1-(2,4-dichlorophenyl)-3-(4-nitrophenyl)-3-(1,2,4-triazol-1-yl)prop-2-en-1-one (PubChem CID 3399450) has the molecular formula C17H10Cl2N4O3 and a molecular weight of 389.20 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(4-nitrophenyl)-3-(1,2,4-triazol-1-yl)prop-2-en-1-one.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(4-nitrophenyl)-3-(1,2,4-triazol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3399450 |
| Molecular Formula | C17H10Cl2N4O3 |
| Molecular Weight | 389.20 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(4-nitrophenyl)-3-(1,2,4-triazol-1-yl)prop-2-en-1-one |
| SMILES | O=C(C=C(c1ccc([N+](=O)[O-])cc1)n1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H10Cl2N4O3/c18-12-3-6-14(15(19)7-12)17(24)8-16(22-10-20-9-21-22)11-1-4-13(5-2-11)23(25)26/h1-10H |
| InChIKey | SNLLJDKZURNOIR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|