C22H37N3O3S — CID 3418480
5-(octylsulfonylamino)-N-propan-2-yl-2-pyrrolidin-1-ylbenzamide (PubChem CID 3418480) has the molecular formula C22H37N3O3S and a molecular weight of 423.62 g/mol. Its IUPAC name is 5-(octylsulfonylamino)-N-propan-2-yl-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-(octylsulfonylamino)-N-propan-2-yl-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 3418480 |
| Molecular Formula | C22H37N3O3S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 5-(octylsulfonylamino)-N-propan-2-yl-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCCCCCCCS(=O)(=O)Nc1ccc(N2CCCC2)c(C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C22H37N3O3S/c1-4-5-6-7-8-11-16-29(27,28)24-19-12-13-21(25-14-9-10-15-25)20(17-19)22(26)23-18(2)3/h12-13,17-18,24H,4-11,14-16H2,1-3H3,(H,23,26) |
| InChIKey | YHBRPNSYZRRWLS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|