C12H11F4NO5S — CID 3419752
2,2,3,3-tetrafluoropropyl 2-(4-methylsulfanyl-2-nitrophenoxy)acetate (PubChem CID 3419752) has the molecular formula C12H11F4NO5S and a molecular weight of 357.28 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 2-(4-methylsulfanyl-2-nitrophenoxy)acetate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 2-(4-methylsulfanyl-2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 3419752 |
| Molecular Formula | C12H11F4NO5S |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 2-(4-methylsulfanyl-2-nitrophenoxy)acetate |
| SMILES | CSc1ccc(OCC(=O)OCC(F)(F)C(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H11F4NO5S/c1-23-7-2-3-9(8(4-7)17(19)20)21-5-10(18)22-6-12(15,16)11(13)14/h2-4,11H,5-6H2,1H3 |
| InChIKey | KJJWPWXQHUNIIG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|