C10H7F4N3O6 — CID 15519290
2,4-dinitro-6-(2,2,3,3-tetrafluoropropoxy)benzamide (PubChem CID 15519290) has the molecular formula C10H7F4N3O6 and a molecular weight of 341.17 g/mol. Its IUPAC name is 2,4-dinitro-6-(2,2,3,3-tetrafluoropropoxy)benzamide.
| Compound Name | 2,4-dinitro-6-(2,2,3,3-tetrafluoropropoxy)benzamide |
|---|---|
| PubChem CID | 15519290 |
| Molecular Formula | C10H7F4N3O6 |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 2,4-dinitro-6-(2,2,3,3-tetrafluoropropoxy)benzamide |
| SMILES | NC(=O)c1c(OCC(F)(F)C(F)F)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7F4N3O6/c11-9(12)10(13,14)3-23-6-2-4(16(19)20)1-5(17(21)22)7(6)8(15)18/h1-2,9H,3H2,(H2,15,18) |
| InChIKey | LZEACDUGUBHABE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|