C11H6N2O4S — CID 3434262
3-(1,3-dioxoisoindol-2-yl)-1,3-thiazolidine-2,4-dione (PubChem CID 3434262) has the molecular formula C11H6N2O4S and a molecular weight of 262.25 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3434262 |
| Molecular Formula | C11H6N2O4S |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H6N2O4S/c14-8-5-18-11(17)12(8)13-9(15)6-3-1-2-4-7(6)10(13)16/h1-4H,5H2 |
| InChIKey | UYDIAXCNMIKNFD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|