C22H13F3N2O2S2 — CID 34360560
(2Z)-4,4,4-trifluoro-2-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylidene]-1-thiophen-2-ylbutane-1,3-dione (PubChem CID 34360560) has the molecular formula C22H13F3N2O2S2 and a molecular weight of 458.49 g/mol. Its IUPAC name is (2Z)-4,4,4-trifluoro-2-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylidene]-1-thiophen-2-ylbutane-1,3-dione.
| Compound Name | (2Z)-4,4,4-trifluoro-2-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylidene]-1-thiophen-2-ylbutane-1,3-dione |
|---|---|
| PubChem CID | 34360560 |
| Molecular Formula | C22H13F3N2O2S2 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | (2Z)-4,4,4-trifluoro-2-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylidene]-1-thiophen-2-ylbutane-1,3-dione |
| SMILES | O=C(/C(=C\c1cn(-c2ccccc2)nc1-c1cccs1)C(=O)C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C22H13F3N2O2S2/c23-22(24,25)21(29)16(20(28)18-9-5-11-31-18)12-14-13-27(15-6-2-1-3-7-15)26-19(14)17-8-4-10-30-17/h1-13H/b16-12+ |
| InChIKey | GECDEBDFQKEWKT-FOWTUZBSSA-N |
| XLogP | 6.06 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|