C26H27N9O2S — CID 3437259
N-(2-cyanoethyl)-2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-carboxamide (PubChem CID 3437259) has the molecular formula C26H27N9O2S and a molecular weight of 529.63 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-cyanoethyl)-2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3437259 |
| Molecular Formula | C26H27N9O2S |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | N-(2-cyanoethyl)-2-[1-(4,7-dimethylpyrazolo[5,1-c][1,2,4]triazine-3-carbonyl)piperidin-4-yl]-N-(pyridin-3-ylmethyl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cc2nnc(C(=O)N3CCC(c4nc(C(=O)N(CCC#N)Cc5cccnc5)cs4)CC3)c(C)n2n1 |
| InChI | InChI=1S/C26H27N9O2S/c1-17-13-22-30-31-23(18(2)35(22)32-17)26(37)33-11-6-20(7-12-33)24-29-21(16-38-24)25(36)34(10-4-8-27)15-19-5-3-9-28-14-19/h3,5,9,13-14,16,20H,4,6-7,10-12,15H2,1-2H3 |
| InChIKey | AZNXQDQKPVOCGY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 133.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |