C18H20Br2N4O3 — CID 3439991
N-(2,4-dibromo-6-methylphenyl)-2-[3-(4-nitroanilino)propylamino]acetamide (PubChem CID 3439991) has the molecular formula C18H20Br2N4O3 and a molecular weight of 500.19 g/mol. Its IUPAC name is N-(2,4-dibromo-6-methylphenyl)-2-[3-(4-nitroanilino)propylamino]acetamide.
| Compound Name | N-(2,4-dibromo-6-methylphenyl)-2-[3-(4-nitroanilino)propylamino]acetamide |
|---|---|
| PubChem CID | 3439991 |
| Molecular Formula | C18H20Br2N4O3 |
| Molecular Weight | 500.19 g/mol |
| Exact Mass | 497.99 |
| IUPAC Name | N-(2,4-dibromo-6-methylphenyl)-2-[3-(4-nitroanilino)propylamino]acetamide |
| SMILES | Cc1cc(Br)cc(Br)c1NC(=O)CNCCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H20Br2N4O3/c1-12-9-13(19)10-16(20)18(12)23-17(25)11-21-7-2-8-22-14-3-5-15(6-4-14)24(26)27/h3-6,9-10,21-22H,2,7-8,11H2,1H3,(H,23,25) |
| InChIKey | NMFDXWXCWYTTLM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.19 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|