C13H9F3N4O3 — CID 3455236
2-amino-3-(1,3-benzodioxol-5-ylmethylideneamino)-6-(trifluoromethyl)pyrimidin-4-one (PubChem CID 3455236) has the molecular formula C13H9F3N4O3 and a molecular weight of 326.23 g/mol. Its IUPAC name is 2-amino-3-(1,3-benzodioxol-5-ylmethylideneamino)-6-(trifluoromethyl)pyrimidin-4-one.
| Compound Name | 2-amino-3-(1,3-benzodioxol-5-ylmethylideneamino)-6-(trifluoromethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 3455236 |
| Molecular Formula | C13H9F3N4O3 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-amino-3-(1,3-benzodioxol-5-ylmethylideneamino)-6-(trifluoromethyl)pyrimidin-4-one |
| SMILES | Nc1nc(C(F)(F)F)cc(=O)n1N=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H9F3N4O3/c14-13(15,16)10-4-11(21)20(12(17)19-10)18-5-7-1-2-8-9(3-7)23-6-22-8/h1-5H,6H2,(H2,17,19) |
| InChIKey | GOWLLGDLSKVUPL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|