C16H16N6O3 — CID 3623110
8-(1,3-benzodioxol-5-ylmethylideneamino)-6-tert-butyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one (PubChem CID 3623110) has the molecular formula C16H16N6O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is 8-(1,3-benzodioxol-5-ylmethylideneamino)-6-tert-butyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one.
| Compound Name | 8-(1,3-benzodioxol-5-ylmethylideneamino)-6-tert-butyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one |
|---|---|
| PubChem CID | 3623110 |
| Molecular Formula | C16H16N6O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 8-(1,3-benzodioxol-5-ylmethylideneamino)-6-tert-butyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one |
| SMILES | CC(C)(C)c1nn2cnnc2n(N=Cc2ccc3c(c2)OCO3)c1=O |
| InChI | InChI=1S/C16H16N6O3/c1-16(2,3)13-14(23)22(15-19-17-8-21(15)20-13)18-7-10-4-5-11-12(6-10)25-9-24-11/h4-8H,9H2,1-3H3 |
| InChIKey | QMMPXMCYFIPDJK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 95.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|