C19H16F2N2O6S — CID 34572910
[2-[4-(difluoromethylsulfonyl)anilino]-2-oxoethyl] 6-methoxy-1H-indole-2-carboxylate (PubChem CID 34572910) has the molecular formula C19H16F2N2O6S and a molecular weight of 438.41 g/mol. Its IUPAC name is [2-[4-(difluoromethylsulfonyl)anilino]-2-oxoethyl] 6-methoxy-1H-indole-2-carboxylate.
| Compound Name | [2-[4-(difluoromethylsulfonyl)anilino]-2-oxoethyl] 6-methoxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 34572910 |
| Molecular Formula | C19H16F2N2O6S |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | [2-[4-(difluoromethylsulfonyl)anilino]-2-oxoethyl] 6-methoxy-1H-indole-2-carboxylate |
| SMILES | COc1ccc2cc(C(=O)OCC(=O)Nc3ccc(S(=O)(=O)C(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C19H16F2N2O6S/c1-28-13-5-2-11-8-16(23-15(11)9-13)18(25)29-10-17(24)22-12-3-6-14(7-4-12)30(26,27)19(20)21/h2-9,19,23H,10H2,1H3,(H,22,24) |
| InChIKey | UFGIIQLXOYSJBG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |