C26H18N2O6 — CID 34503940
[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 6-methoxy-1H-indole-2-carboxylate (PubChem CID 34503940) has the molecular formula C26H18N2O6 and a molecular weight of 454.44 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 6-methoxy-1H-indole-2-carboxylate.
| Compound Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 6-methoxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 34503940 |
| Molecular Formula | C26H18N2O6 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 6-methoxy-1H-indole-2-carboxylate |
| SMILES | COc1ccc2cc(C(=O)OCC(=O)Nc3cccc4c3C(=O)c3ccccc3C4=O)[nH]c2c1 |
| InChI | InChI=1S/C26H18N2O6/c1-33-15-10-9-14-11-21(27-20(14)12-15)26(32)34-13-22(29)28-19-8-4-7-18-23(19)25(31)17-6-3-2-5-16(17)24(18)30/h2-12,27H,13H2,1H3,(H,28,29) |
| InChIKey | XNBJEGWGSYANPY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|