C28H30N2O5 — CID 3472051
[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate (PubChem CID 3472051) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate.
| Compound Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 3472051 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)OCC(=O)C=C1N(C)c2ccccc2C1(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H30N2O5/c1-17(2)14-23(30-25(32)19-10-6-7-11-20(19)26(30)33)27(34)35-16-18(31)15-24-28(3,4)21-12-8-9-13-22(21)29(24)5/h6-13,15,17,23H,14,16H2,1-5H3 |
| InChIKey | JFLXQYQMRDGKRG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|