C24H25N3O5S — CID 135756781
[(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135756781) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135756781 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | C[C@@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)OCC(=O)/C=C1/N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C24H25N3O5S/c1-15(25-22-17-9-5-8-12-20(17)33(30,31)26-22)23(29)32-14-16(28)13-21-24(2,3)18-10-6-7-11-19(18)27(21)4/h5-13,15H,14H2,1-4H3,(H,25,26)/b21-13+/t15-/m1/s1 |
| InChIKey | MBKAKUQEZISTKM-NWGMWSOJSA-N |
| XLogP | 2.54 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|