C32H27NO2 — CID 3496825
1-(2-hydroxyphenyl)-2,4,6-tris(4-methylphenyl)pyridin-1-ium-3-olate (PubChem CID 3496825) has the molecular formula C32H27NO2 and a molecular weight of 457.57 g/mol. Its IUPAC name is 1-(2-hydroxyphenyl)-2,4,6-tris(4-methylphenyl)pyridin-1-ium-3-olate.
| Compound Name | 1-(2-hydroxyphenyl)-2,4,6-tris(4-methylphenyl)pyridin-1-ium-3-olate |
|---|---|
| PubChem CID | 3496825 |
| Molecular Formula | C32H27NO2 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 1-(2-hydroxyphenyl)-2,4,6-tris(4-methylphenyl)pyridin-1-ium-3-olate |
| SMILES | Cc1ccc(-c2cc(-c3ccc(C)cc3)[n+](-c3ccccc3O)c(-c3ccc(C)cc3)c2[O-])cc1 |
| InChI | InChI=1S/C32H27NO2/c1-21-8-14-24(15-9-21)27-20-29(25-16-10-22(2)11-17-25)33(28-6-4-5-7-30(28)34)31(32(27)35)26-18-12-23(3)13-19-26/h4-20H,1-3H3,(H-,34,35) |
| InChIKey | XXPBOMACSRRLGG-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 47.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|