C36H29NO2 — CID 3800412
1-(2-hydroxynaphthalen-1-yl)-2,4,6-tris(4-methylphenyl)pyridin-1-ium-3-olate (PubChem CID 3800412) has the molecular formula C36H29NO2 and a molecular weight of 507.63 g/mol. Its IUPAC name is 1-(2-hydroxynaphthalen-1-yl)-2,4,6-tris(4-methylphenyl)pyridin-1-ium-3-olate.
| Compound Name | 1-(2-hydroxynaphthalen-1-yl)-2,4,6-tris(4-methylphenyl)pyridin-1-ium-3-olate |
|---|---|
| PubChem CID | 3800412 |
| Molecular Formula | C36H29NO2 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 1-(2-hydroxynaphthalen-1-yl)-2,4,6-tris(4-methylphenyl)pyridin-1-ium-3-olate |
| SMILES | Cc1ccc(-c2cc(-c3ccc(C)cc3)[n+](-c3c(O)ccc4ccccc34)c(-c3ccc(C)cc3)c2[O-])cc1 |
| InChI | InChI=1S/C36H29NO2/c1-23-8-14-27(15-9-23)31-22-32(28-16-10-24(2)11-17-28)37(34(36(31)39)29-18-12-25(3)13-19-29)35-30-7-5-4-6-26(30)20-21-33(35)38/h4-22H,1-3H3,(H-,38,39) |
| InChIKey | SIQHFTBGKCBWCY-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 47.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|