C15H19N4O3+ — CID 3505690
2-morpholin-4-ium-4-ylidene-6-oxo-N-phenyl-1,3-diazinane-4-carboxamide (PubChem CID 3505690) has the molecular formula C15H19N4O3+ and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-morpholin-4-ium-4-ylidene-6-oxo-N-phenyl-1,3-diazinane-4-carboxamide.
| Compound Name | 2-morpholin-4-ium-4-ylidene-6-oxo-N-phenyl-1,3-diazinane-4-carboxamide |
|---|---|
| PubChem CID | 3505690 |
| Molecular Formula | C15H19N4O3+ |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-morpholin-4-ium-4-ylidene-6-oxo-N-phenyl-1,3-diazinane-4-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2ccccc2)NC(=[N+]2CCOCC2)N1 |
| InChI | InChI=1S/C15H18N4O3/c20-13-10-12(14(21)16-11-4-2-1-3-5-11)17-15(18-13)19-6-8-22-9-7-19/h1-5,12H,6-10H2,(H2,16,17,18,20,21)/p+1 |
| InChIKey | DQUMAOWQILUOEV-UHFFFAOYSA-O |
| XLogP | -0.50 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|