C12H13N3O3S — CID 163758060
(4S)-2,6-dioxo-N-[4-(sulfanylmethyl)phenyl]-1,3-diazinane-4-carboxamide (PubChem CID 163758060) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is (4S)-2,6-dioxo-N-[4-(sulfanylmethyl)phenyl]-1,3-diazinane-4-carboxamide.
| Compound Name | (4S)-2,6-dioxo-N-[4-(sulfanylmethyl)phenyl]-1,3-diazinane-4-carboxamide |
|---|---|
| PubChem CID | 163758060 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | (4S)-2,6-dioxo-N-[4-(sulfanylmethyl)phenyl]-1,3-diazinane-4-carboxamide |
| SMILES | O=C1C[C@@H](C(=O)Nc2ccc(CS)cc2)NC(=O)N1 |
| InChI | InChI=1S/C12H13N3O3S/c16-10-5-9(14-12(18)15-10)11(17)13-8-3-1-7(6-19)2-4-8/h1-4,9,19H,5-6H2,(H,13,17)(H2,14,15,16,18)/t9-/m0/s1 |
| InChIKey | LVUSDERKVAQIDW-VIFPVBQESA-N |
| XLogP | 0.65 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|