C19H18ClN4O2+ — CID 7328242
(4S)-N-(4-chlorophenyl)-2-(2,3-dihydroindol-1-ium-1-ylidene)-6-oxo-1,3-diazinane-4-carboxamide (PubChem CID 7328242) has the molecular formula C19H18ClN4O2+ and a molecular weight of 369.83 g/mol. Its IUPAC name is (4S)-N-(4-chlorophenyl)-2-(2,3-dihydroindol-1-ium-1-ylidene)-6-oxo-1,3-diazinane-4-carboxamide.
| Compound Name | (4S)-N-(4-chlorophenyl)-2-(2,3-dihydroindol-1-ium-1-ylidene)-6-oxo-1,3-diazinane-4-carboxamide |
|---|---|
| PubChem CID | 7328242 |
| Molecular Formula | C19H18ClN4O2+ |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (4S)-N-(4-chlorophenyl)-2-(2,3-dihydroindol-1-ium-1-ylidene)-6-oxo-1,3-diazinane-4-carboxamide |
| SMILES | O=C1C[C@@H](C(=O)Nc2ccc(Cl)cc2)N/C(=[N+]2\CCc3ccccc32)N1 |
| InChI | InChI=1S/C19H17ClN4O2/c20-13-5-7-14(8-6-13)21-18(26)15-11-17(25)23-19(22-15)24-10-9-12-3-1-2-4-16(12)24/h1-8,15H,9-11H2,(H2,21,22,23,25,26)/p+1/t15-/m0/s1 |
| InChIKey | WJWROQUVJMCXMS-HNNXBMFYSA-O |
| XLogP | 2.01 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|