C9H9ClN6 — CID 35072
2-N-(4-chlorophenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 35072) has the molecular formula C9H9ClN6 and a molecular weight of 236.66 g/mol. Its IUPAC name is 2-N-(4-chlorophenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(4-chlorophenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 35072 |
| Molecular Formula | C9H9ClN6 |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 2-N-(4-chlorophenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | C1=CC(=CC=C1NC2=NC(=NC(=N2)N)N)Cl |
| InChIKey | KYDAUSBHOHGKTN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | 210 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |