C20H20N6O — CID 35338056
6-[4-(4-methoxyphenyl)piperazin-1-yl]-[1,2,4]triazolo[3,4-a]phthalazine (PubChem CID 35338056) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is 6-[4-(4-methoxyphenyl)piperazin-1-yl]-[1,2,4]triazolo[3,4-a]phthalazine.
| Compound Name | 6-[4-(4-methoxyphenyl)piperazin-1-yl]-[1,2,4]triazolo[3,4-a]phthalazine |
|---|---|
| PubChem CID | 35338056 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 6-[4-(4-methoxyphenyl)piperazin-1-yl]-[1,2,4]triazolo[3,4-a]phthalazine |
| SMILES | COc1ccc(N2CCN(c3nn4cnnc4c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C20H20N6O/c1-27-16-8-6-15(7-9-16)24-10-12-25(13-11-24)20-18-5-3-2-4-17(18)19-22-21-14-26(19)23-20/h2-9,14H,10-13H2,1H3 |
| InChIKey | YADLKABTZDOIFU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|