C21H18N6O5S — CID 35341807
N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide (PubChem CID 35341807) has the molecular formula C21H18N6O5S and a molecular weight of 466.48 g/mol. Its IUPAC name is N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide.
| Compound Name | N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 35341807 |
| Molecular Formula | C21H18N6O5S |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzamide |
| SMILES | Cn1cnnc1Sc1ccc(C(=O)Nc2ccc(CN3C(=O)CCC3=O)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H18N6O5S/c1-25-12-22-24-21(25)33-17-7-4-14(10-16(17)27(31)32)20(30)23-15-5-2-13(3-6-15)11-26-18(28)8-9-19(26)29/h2-7,10,12H,8-9,11H2,1H3,(H,23,30) |
| InChIKey | HMSSNNCPFUKTBP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 140.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|