C36H38N2O6S — CID 3556287
N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]-5-(dimethylamino)naphthalene-1-sulfonamide (PubChem CID 3556287) has the molecular formula C36H38N2O6S and a molecular weight of 626.78 g/mol. Its IUPAC name is N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]-5-(dimethylamino)naphthalene-1-sulfonamide.
| Compound Name | N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]-5-(dimethylamino)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 3556287 |
| Molecular Formula | C36H38N2O6S |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-hydroxypropan-2-yl]-5-(dimethylamino)naphthalene-1-sulfonamide |
| SMILES | COc1ccc(C(OCC(CO)NS(=O)(=O)c2cccc3c(N(C)C)cccc23)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H38N2O6S/c1-38(2)34-14-8-13-33-32(34)12-9-15-35(33)45(40,41)37-29(24-39)25-44-36(26-10-6-5-7-11-26,27-16-20-30(42-3)21-17-27)28-18-22-31(43-4)23-19-28/h5-23,29,37,39H,24-25H2,1-4H3 |
| InChIKey | GHCIHIOIYWSFSW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|