C25H27N3O6S — CID 35779863
N-[(E)-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]naphthalene-2-sulfonamide (PubChem CID 35779863) has the molecular formula C25H27N3O6S and a molecular weight of 497.57 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]naphthalene-2-sulfonamide.
| Compound Name | N-[(E)-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 35779863 |
| Molecular Formula | C25H27N3O6S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | N-[(E)-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]naphthalene-2-sulfonamide |
| SMILES | CCOc1cc(/C=N/NS(=O)(=O)c2ccc3ccccc3c2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H27N3O6S/c1-2-33-24-15-19(7-10-23(24)34-18-25(29)28-11-13-32-14-12-28)17-26-27-35(30,31)22-9-8-20-5-3-4-6-21(20)16-22/h3-10,15-17,27H,2,11-14,18H2,1H3/b26-17+ |
| InChIKey | CXOUCGBKDIDXTL-YZSQISJMSA-N |
| XLogP | 2.79 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|