C34H38N2O4 — CID 3587184
3,5-dimethoxy-N-[4-[[3-(4-methylphenyl)-1-adamantyl]methylcarbamoyl]phenyl]benzamide (PubChem CID 3587184) has the molecular formula C34H38N2O4 and a molecular weight of 538.69 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[4-[[3-(4-methylphenyl)-1-adamantyl]methylcarbamoyl]phenyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[4-[[3-(4-methylphenyl)-1-adamantyl]methylcarbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 3587184 |
| Molecular Formula | C34H38N2O4 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | 3,5-dimethoxy-N-[4-[[3-(4-methylphenyl)-1-adamantyl]methylcarbamoyl]phenyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(C(=O)NCC34CC5CC(C3)CC(c3ccc(C)cc3)(C5)C4)cc2)c1 |
| InChI | InChI=1S/C34H38N2O4/c1-22-4-8-27(9-5-22)34-18-23-12-24(19-34)17-33(16-23,20-34)21-35-31(37)25-6-10-28(11-7-25)36-32(38)26-13-29(39-2)15-30(14-26)40-3/h4-11,13-15,23-24H,12,16-21H2,1-3H3,(H,35,37)(H,36,38) |
| InChIKey | UUNQQVCIMYCIBU-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |