C18H23N5O2S — CID 35949916
2-[4-[(4-amino-5-tert-butyl-1,2,4-triazol-3-yl)sulfanyl]butyl]isoindole-1,3-dione (PubChem CID 35949916) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 2-[4-[(4-amino-5-tert-butyl-1,2,4-triazol-3-yl)sulfanyl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(4-amino-5-tert-butyl-1,2,4-triazol-3-yl)sulfanyl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 35949916 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-[4-[(4-amino-5-tert-butyl-1,2,4-triazol-3-yl)sulfanyl]butyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)c1nnc(SCCCCN2C(=O)c3ccccc3C2=O)n1N |
| InChI | InChI=1S/C18H23N5O2S/c1-18(2,3)16-20-21-17(23(16)19)26-11-7-6-10-22-14(24)12-8-4-5-9-13(12)15(22)25/h4-5,8-9H,6-7,10-11,19H2,1-3H3 |
| InChIKey | WZSSMNGEIADMKI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|