C17H23ClN4O3 — CID 35960340
(2R)-2-(5-chloro-2,4-dimethoxyanilino)-N-(1,3,5-trimethylpyrazol-4-yl)propanamide (PubChem CID 35960340) has the molecular formula C17H23ClN4O3 and a molecular weight of 366.85 g/mol. Its IUPAC name is (2R)-2-(5-chloro-2,4-dimethoxyanilino)-N-(1,3,5-trimethylpyrazol-4-yl)propanamide.
| Compound Name | (2R)-2-(5-chloro-2,4-dimethoxyanilino)-N-(1,3,5-trimethylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 35960340 |
| Molecular Formula | C17H23ClN4O3 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (2R)-2-(5-chloro-2,4-dimethoxyanilino)-N-(1,3,5-trimethylpyrazol-4-yl)propanamide |
| SMILES | COc1cc(OC)c(N[C@H](C)C(=O)Nc2c(C)nn(C)c2C)cc1Cl |
| InChI | InChI=1S/C17H23ClN4O3/c1-9-16(11(3)22(4)21-9)20-17(23)10(2)19-13-7-12(18)14(24-5)8-15(13)25-6/h7-8,10,19H,1-6H3,(H,20,23)/t10-/m1/s1 |
| InChIKey | YKNOJDUDRHEPTD-SNVBAGLBSA-N |
| XLogP | 3.15 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|